 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Oc1ccc(cc1)CC([NH3+])C(=O)NCC(=O)NCC(=O)NC(Cc1ccccc1)C(=O)NC (CC(C)C)C(=O)N |
| InChI: | InChI=1/C28H38N6O6/c1-17(2)12-22(26(30)38)34-28(40)23(14-18-6-4-3-5-7-18)33-25(37)16-31-24(36)15-32-27(39)21(29)13-19-8-10-20(35)11-9-19/h3-11,17,21-23,35H,12-16,29H2,1-2H3,(H2,30,38)(H,31,36)(H,32,39)(H,33,37)(H,34,40)/p+1/t21-,22-,23-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=101.039 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 555.656 g/mol | logS: -5.08256 | SlogP: -1.47876 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0480438 | Sterimol/B1: 2.194 | Sterimol/B2: 4.13143 | Sterimol/B3: 4.82331 | |||
| Sterimol/B4: 11.5252 | Sterimol/L: 25.1337 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 960.082 | Positive charged surface: 637.199 | Negative charged surface: 322.883 | Volume: 541.875 | |||
| Hydrophobic surface: 571.018 | Hydrophilic surface: 389.064 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 6 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 0 | Violations of Lipinski's rule: 3 | Oprea's lead like rule: 0 | ||||
|
