 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(CO)C(O)C(O)C1n1c2N=C(NC(=O)c2nc1)NC(=O)c1ccccc1 |
| InChI: | InChI=1/C17H17N5O6/c23-6-9-11(24)12(25)16(28-9)22-7-18-10-13(22)19-17(21-15(10)27)20-14(26)8-4-2-1-3-5-8/h1-5,7,9,11-12,16,23-25H,6H2,(H2,19,20,21,26,27)/t9-,11+,12-,16-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=106.892 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 387.352 g/mol | logS: -2.71488 | SlogP: -1.249 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0417618 | Sterimol/B1: 3.2721 | Sterimol/B2: 3.6097 | Sterimol/B3: 3.76797 | |||
| Sterimol/B4: 9.06754 | Sterimol/L: 17.4485 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 611.655 | Positive charged surface: 398.251 | Negative charged surface: 213.404 | Volume: 326.25 | |||
| Hydrophobic surface: 337.1 | Hydrophilic surface: 274.555 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.