 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(CO)C(O)C(O)C1n1c2N=C(NC(=O)c2nc1)NC(=O)c1ccccc1 |
| InChI: | InChI=1/C17H17N5O6/c23-6-9-11(24)12(25)16(28-9)22-7-18-10-13(22)19-17(21-15(10)27)20-14(26)8-4-2-1-3-5-8/h1-5,7,9,11-12,16,23-25H,6H2,(H2,19,20,21,26,27)/t9-,11+,12+,16+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=125.31 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 387.352 g/mol | logS: -2.71488 | SlogP: -1.249 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0285138 | Sterimol/B1: 2.95627 | Sterimol/B2: 3.34105 | Sterimol/B3: 3.60828 | |||
| Sterimol/B4: 8.43438 | Sterimol/L: 18.0433 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 600.004 | Positive charged surface: 379.062 | Negative charged surface: 220.942 | Volume: 324.5 | |||
| Hydrophobic surface: 320.058 | Hydrophilic surface: 279.946 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
