Type: Neutral
Formula: C10H12N4O5
SMILES: |
O1C(CO)C(O)C(O)C1n1ncc2c1N=CNC2=O |
InChI: |
InChI=1/C10H12N4O5/c15-2-5-6(16)7(17)10(19-5)14-8-4(1-13-14)9(18)12-3-11-8/h1,3,5-7,10,15-17H,2H2,(H,11,12,18)/t5-,6+,7-,10+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 268.229 g/mol | logS: -0.29363 | SlogP: -2.0067 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.108316 | Sterimol/B1: 2.33076 | Sterimol/B2: 2.33193 | Sterimol/B3: 4.11953 |
Sterimol/B4: 5.76556 | Sterimol/L: 12.7815 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 447.942 | Positive charged surface: 328.022 | Negative charged surface: 119.92 | Volume: 218.875 |
Hydrophobic surface: 175.257 | Hydrophilic surface: 272.685 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules
|