 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C2C(OC(OC2)c2ccccc2)C(O)C(NC(=O)c2ccccc2)C1OC |
| InChI: | InChI=1/C21H23NO6/c1-25-21-16(22-19(24)13-8-4-2-5-9-13)17(23)18-15(27-21)12-26-20(28-18)14-10-6-3-7-11-14/h2-11,15-18,20-21,23H,12H2,1H3,(H,22,24)/t15-,16-,17-,18-,20-,21-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=108.92 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 385.416 g/mol | logS: -3.72607 | SlogP: 1.7269 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0392849 | Sterimol/B1: 2.09476 | Sterimol/B2: 2.49612 | Sterimol/B3: 4.24166 | |||
| Sterimol/B4: 8.74216 | Sterimol/L: 19.3254 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 658.769 | Positive charged surface: 428.264 | Negative charged surface: 230.505 | Volume: 359.625 | |||
| Hydrophobic surface: 577.198 | Hydrophilic surface: 81.571 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 6 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.