 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC1CCC2C(CC3[NH+](C2)CCc2c3[nH]c3c2cccc3)C1C[NH+]1CCCCC1 |
| InChI: | InChI=1/C25H35N3O/c29-24-9-8-17-15-28-13-10-19-18-6-2-3-7-22(18)26-25(19)23(28)14-20(17)21(24)16-27-11-4-1-5-12-27/h2-3,6-7,17,20-21,23-24,26,29H,1,4-5,8-16H2/p+2/t17-,20-,21+,23+,24-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=66.8131 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 395.591 g/mol | logS: -3.41572 | SlogP: 1.22127 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0694183 | Sterimol/B1: 3.35784 | Sterimol/B2: 3.42348 | Sterimol/B3: 3.90901 | |||
| Sterimol/B4: 9.01007 | Sterimol/L: 17.7779 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 677.534 | Positive charged surface: 538.964 | Negative charged surface: 132.882 | Volume: 413.25 | |||
| Hydrophobic surface: 596.983 | Hydrophilic surface: 80.551 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 2 | |||
| Chiral centers: 5 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
