 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC(C[NH+]1C2C(CCCC2)CCC1)C1c2c(N(c3c1cccc3)C(=O)C)cccc2 |
| InChI: | InChI=1/C26H32N2O2/c1-18(29)28-23-14-6-3-11-20(23)26(21-12-4-7-15-24(21)28)25(30)17-27-16-8-10-19-9-2-5-13-22(19)27/h3-4,6-7,11-12,14-15,19,22,25-26,30H,2,5,8-10,13,16-17H2,1H3/p+1/t19-,22+,25+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=112.726 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 405.562 g/mol | logS: -4.91323 | SlogP: 3.4149 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.181457 | Sterimol/B1: 2.41165 | Sterimol/B2: 5.28331 | Sterimol/B3: 6.26244 | |||
| Sterimol/B4: 7.42528 | Sterimol/L: 15.7512 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 665.063 | Positive charged surface: 469.393 | Negative charged surface: 195.67 | Volume: 418.75 | |||
| Hydrophobic surface: 611.568 | Hydrophilic surface: 53.495 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
