Type: Neutral
Formula: C2H6O9S3
SMILES: |
S(O)(=O)(=O)C(S(O)(=O)=O)CS(O)(=O)=O |
InChI: |
InChI=1/C2H6O9S3/c3-12(4,5)1-2(13(6,7)8)14(9,10)11/h2H,1H2,(H,3,4,5)(H,6,7,8)(H,9,10,11) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 270.259 g/mol | logS: 0.46708 | SlogP: -3.7212 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.170859 | Sterimol/B1: 3.26821 | Sterimol/B2: 3.38409 | Sterimol/B3: 3.44859 |
Sterimol/B4: 5.10912 | Sterimol/L: 10.4305 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 352.982 | Positive charged surface: 137.385 | Negative charged surface: 215.598 | Volume: 153.125 |
Hydrophobic surface: 43.694 | Hydrophilic surface: 309.288 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 9 | Hydrogen bond acceptors: 9 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules
|