Type: Neutral
Formula: C10H14N6O3
SMILES: |
O1C(CO)C(N)C(O)C1n1c2ncnc(N)c2nc1 |
InChI: |
InChI=1/C10H14N6O3/c11-5-4(1-17)19-10(7(5)18)16-3-15-6-8(12)13-2-14-9(6)16/h2-5,7,10,17-18H,1,11H2,(H2,12,13,14)/t4-,5+,7-,10-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 266.261 g/mol | logS: -0.85658 | SlogP: -1.9181 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0828058 | Sterimol/B1: 2.71524 | Sterimol/B2: 2.72391 | Sterimol/B3: 4.51197 |
Sterimol/B4: 5.36326 | Sterimol/L: 13.746 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 457.406 | Positive charged surface: 352.157 | Negative charged surface: 105.249 | Volume: 227.625 |
Hydrophobic surface: 159.12 | Hydrophilic surface: 298.286 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |