Type: Neutral
Formula: C18H22N4O7
SMILES: |
O=C1NC(=O)N=C2N(c3cc(C)c(cc3N=C12)C)CC(O)C(O)C(O)C(O)CO |
InChI: |
InChI=1/C18H22N4O7/c1-7-3-9-10(4-8(7)2)22(5-11(24)14(26)15(27)12(25)6-23)16-13(19-9)17(28)21-18(29)20-16/h3-4,11-12,14-15,23-27H,5-6H2,1-2H3,(H,21,28,29)/t11-,12-,14-,15-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 406.395 g/mol | logS: -2.88005 | SlogP: -1.71986 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.059838 | Sterimol/B1: 2.61198 | Sterimol/B2: 2.62411 | Sterimol/B3: 3.86012 |
Sterimol/B4: 10.445 | Sterimol/L: 16.3085 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 618.427 | Positive charged surface: 385.514 | Negative charged surface: 232.914 | Volume: 351.375 |
Hydrophobic surface: 286.4 | Hydrophilic surface: 332.027 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 9 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 0 | Violations of Lipinski's rule: 2 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |