 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1NC(=NC=2NCC(=NC1=2)CNc1ccc(cc1)C(=O)NC(CCC(O)=O)C(O)=O)N |
| InChI: | InChI=1/C19H21N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,12,21H,5-8H2,(H,24,29)(H,27,28)(H,31,32)(H4,20,22,25,26,30)/t12-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=81.6475 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 443.42 g/mol | logS: -3.18832 | SlogP: -1.1959 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0283185 | Sterimol/B1: 2.38404 | Sterimol/B2: 2.86739 | Sterimol/B3: 4.6346 | |||
| Sterimol/B4: 7.72923 | Sterimol/L: 21.5283 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 718.969 | Positive charged surface: 469.984 | Negative charged surface: 248.984 | Volume: 381.5 | |||
| Hydrophobic surface: 265.051 | Hydrophilic surface: 453.918 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 9 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 0 | Violations of Lipinski's rule: 2 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules
