 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(CC(NC(=O)CCC([NH3+])C(=O)[O-])C(=O)NCC(=O)[O-])CCCCCC |
| InChI: | InChI=1/C16H29N3O6S/c1-2-3-4-5-8-26-10-12(15(23)18-9-14(21)22)19-13(20)7-6-11(17)16(24)25/h11-12H,2-10,17H2,1H3,(H,18,23)(H,19,20)(H,21,22)(H,24,25)/p-1/t11-,12-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=38.2747 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 390.481 g/mol | logS: -3.26544 | SlogP: -3.2086 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0369037 | Sterimol/B1: 3.6506 | Sterimol/B2: 3.66331 | Sterimol/B3: 4.14159 | |||
| Sterimol/B4: 11.3194 | Sterimol/L: 20.6092 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 732.129 | Positive charged surface: 478.416 | Negative charged surface: 253.713 | Volume: 367 | |||
| Hydrophobic surface: 367.377 | Hydrophilic surface: 364.752 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 4 | Basic groups: 1 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
