Type: Ionized
Formula: C6H10O10P-3
SMILES: |
P(OCC(O)C(O)C(O)C(O)C(=O)[O-])(=O)([O-])[O-] |
InChI: |
InChI=1/C6H13O10P/c7-2(1-16-17(13,14)15)3(8)4(9)5(10)6(11)12/h2-5,7-10H,1H2,(H,11,12)(H2,13,14,15)/p-3/t2-,3-,4+,5+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 273.11 g/mol | logS: 1.23525 | SlogP: -7.045 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.120903 | Sterimol/B1: 2.72393 | Sterimol/B2: 3.04471 | Sterimol/B3: 3.97618 |
Sterimol/B4: 4.22036 | Sterimol/L: 13.2097 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 405.549 | Positive charged surface: 168.103 | Negative charged surface: 237.445 | Volume: 188.5 |
Hydrophobic surface: 89.2288 | Hydrophilic surface: 316.3202 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 5 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Parent related molecule:
|