Type: Ionized
Formula: C6H10O10P-3
SMILES: |
P(OCC(O)C(O)C(O)C(O)C(=O)[O-])(=O)([O-])[O-] |
InChI: |
InChI=1/C6H13O10P/c7-2(1-16-17(13,14)15)3(8)4(9)5(10)6(11)12/h2-5,7-10H,1H2,(H,11,12)(H2,13,14,15)/p-3/t2-,3-,4-,5-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 273.11 g/mol | logS: 1.23525 | SlogP: -7.045 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0569232 | Sterimol/B1: 2.73639 | Sterimol/B2: 3.37003 | Sterimol/B3: 3.46509 |
Sterimol/B4: 3.74393 | Sterimol/L: 14.4167 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 412.647 | Positive charged surface: 171.672 | Negative charged surface: 240.976 | Volume: 189.125 |
Hydrophobic surface: 88.9967 | Hydrophilic surface: 323.6503 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 5 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Parent related molecule:
|