Type: Neutral
Formula: C11H17N3O5
SMILES: |
O1C(CO)C(NOC)CC1N1C=C(C)C(=O)NC1=O |
InChI: |
InChI=1/C11H17N3O5/c1-6-4-14(11(17)12-10(6)16)9-3-7(13-18-2)8(5-15)19-9/h4,7-9,13,15H,3,5H2,1-2H3,(H,12,16,17)/t7-,8-,9-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 271.273 g/mol | logS: -0.33538 | SlogP: -0.9311 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.130728 | Sterimol/B1: 2.68747 | Sterimol/B2: 4.10503 | Sterimol/B3: 4.97587 |
Sterimol/B4: 5.78016 | Sterimol/L: 13.8286 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 494.51 | Positive charged surface: 362.88 | Negative charged surface: 131.629 | Volume: 240.5 |
Hydrophobic surface: 317.463 | Hydrophilic surface: 177.047 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |