Type: Neutral
Formula: C14H21N3O4S
SMILES: |
S(C(C)C)CC(NC(=O)\C=C\C=1C(=O)NC(=O)NC=1C)CO |
InChI: |
InChI=1/C14H21N3O4S/c1-8(2)22-7-10(6-18)16-12(19)5-4-11-9(3)15-14(21)17-13(11)20/h4-5,8,10,18H,6-7H2,1-3H3,(H,16,19)(H2,15,17,20,21)/b5-4+/t10-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 327.405 g/mol | logS: -2.85095 | SlogP: 0.2747 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0826118 | Sterimol/B1: 2.52835 | Sterimol/B2: 4.25378 | Sterimol/B3: 5.44319 |
Sterimol/B4: 5.51125 | Sterimol/L: 16.373 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 586.812 | Positive charged surface: 376.561 | Negative charged surface: 210.252 | Volume: 301.625 |
Hydrophobic surface: 300.364 | Hydrophilic surface: 286.448 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |