Type: Ionized
Formula: C6H8NO8P-2
SMILES: |
P(O)(O)(=O)CC(=O)NC(CC(=O)[O-])C(=O)[O-] |
InChI: |
InChI=1/C6H10NO8P/c8-4(2-16(13,14)15)7-3(6(11)12)1-5(9)10/h3H,1-2H2,(H,7,8)(H,9,10)(H,11,12)(H2,13,14,15)/p-2/t3-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 253.103 g/mol | logS: 0.51191 | SlogP: -5.5314 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.102398 | Sterimol/B1: 2.85081 | Sterimol/B2: 3.48835 | Sterimol/B3: 3.75918 |
Sterimol/B4: 5.0718 | Sterimol/L: 12.4858 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 402.273 | Positive charged surface: 168.502 | Negative charged surface: 233.771 | Volume: 179.75 |
Hydrophobic surface: 80.7349 | Hydrophilic surface: 321.5381 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 4 | Acid groups: 4 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Parent related molecule:
|