Type: Neutral
Formula: C6H10NO8P
| SMILES: |
P(O)(O)(=O)CC(=O)NC(CC(O)=O)C(O)=O |
| InChI: |
InChI=1/C6H10NO8P/c8-4(2-16(13,14)15)7-3(6(11)12)1-5(9)10/h3H,1-2H2,(H,7,8)(H,9,10)(H,11,12)(H2,13,14,15)/t3-/m1/s1 |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 255.119 g/mol | logS: 1.03281 | SlogP: -2.862 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.0997461 | Sterimol/B1: 2.96812 | Sterimol/B2: 3.57155 | Sterimol/B3: 4.57106 |
| Sterimol/B4: 5.03937 | Sterimol/L: 11.7288 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 414.976 | Positive charged surface: 234.44 | Negative charged surface: 180.536 | Volume: 186.875 |
| Hydrophobic surface: 87.0511 | Hydrophilic surface: 327.9249 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 8 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
| Chiral centers: 1 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
| |
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules
|