Type: Neutral
Formula: C12H17N3O4
SMILES: |
O=C1NC(=O)NC(C)=C1\C=C\C(=O)NC(CC)CO |
InChI: |
InChI=1/C12H17N3O4/c1-3-8(6-16)14-10(17)5-4-9-7(2)13-12(19)15-11(9)18/h4-5,8,16H,3,6H2,1-2H3,(H,14,17)(H2,13,15,18,19)/b5-4+/t8-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 267.285 g/mol | logS: -1.73363 | SlogP: -0.4569 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0758984 | Sterimol/B1: 2.39785 | Sterimol/B2: 2.68801 | Sterimol/B3: 5.5715 |
Sterimol/B4: 5.69825 | Sterimol/L: 14.9069 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 499.409 | Positive charged surface: 324.494 | Negative charged surface: 174.915 | Volume: 246.125 |
Hydrophobic surface: 251.127 | Hydrophilic surface: 248.282 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |