 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC(CCC(=O)[O-])C(=O)[O-])c1cc(N(Cc2nc3c(nc(nc3N)N)nc2)C) ccc1 |
| InChI: | InChI=1/C20H22N8O5/c1-28(9-11-8-23-17-15(24-11)16(21)26-20(22)27-17)12-4-2-3-10(7-12)18(31)25-13(19(32)33)5-6-14(29)30/h2-4,7-8,13H,5-6,9H2,1H3,(H,25,31)(H,29,30)(H,32,33)(H4,21,22,23,26,27)/p-2/t13-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=93.1082 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 452.431 g/mol | logS: -3.76939 | SlogP: -2.1346 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0477897 | Sterimol/B1: 1.969 | Sterimol/B2: 3.01382 | Sterimol/B3: 6.67676 | |||
| Sterimol/B4: 6.75546 | Sterimol/L: 21.0449 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 720.532 | Positive charged surface: 442.914 | Negative charged surface: 277.618 | Volume: 397.25 | |||
| Hydrophobic surface: 278.098 | Hydrophilic surface: 442.434 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 4 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
