Type: Ionized
Formula: C8H10N2O7-2
SMILES: |
O=C(NC(CC(=O)[O-])C(=O)[O-])CC([NH3+])C(=O)[O-] |
InChI: |
InChI=1/C8H12N2O7/c9-3(7(14)15)1-5(11)10-4(8(16)17)2-6(12)13/h3-4H,1-2,9H2,(H,10,11)(H,12,13)(H,14,15)(H,16,17)/p-2/t3-,4+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 246.175 g/mol | logS: 0.03721 | SlogP: -6.8884 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.124493 | Sterimol/B1: 2.77054 | Sterimol/B2: 3.30675 | Sterimol/B3: 3.61352 |
Sterimol/B4: 5.9381 | Sterimol/L: 12.4384 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 401.042 | Positive charged surface: 188.71 | Negative charged surface: 212.331 | Volume: 192.25 |
Hydrophobic surface: 89.5313 | Hydrophilic surface: 311.5107 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 6 | Basic groups: 1 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Parent related molecule:
|