Type: Neutral
Formula: C21H27N3
SMILES: |
n1c2c(ccc1NNC=1CCCCC=1C1CCCCC1)cccc2 |
InChI: |
InChI=1/C21H27N3/c1-2-8-16(9-3-1)18-11-5-7-13-20(18)23-24-21-15-14-17-10-4-6-12-19(17)22-21/h4,6,10,12,14-16,23H,1-3,5,7-9,11,13H2,(H,22,24) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 321.468 g/mol | logS: -5.28891 | SlogP: 5.5597 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0605979 | Sterimol/B1: 3.56737 | Sterimol/B2: 3.71568 | Sterimol/B3: 4.95049 |
Sterimol/B4: 7.09009 | Sterimol/L: 15.3569 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 591.247 | Positive charged surface: 403.159 | Negative charged surface: 182.553 | Volume: 337.875 |
Hydrophobic surface: 555.798 | Hydrophilic surface: 35.449 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |