Type: Neutral
Formula: C11H13N5O5
SMILES: |
O(C(n1c2ncnc(N)c2nc1)(CO)C=O)C(CO)C=O |
InChI: |
InChI=1/C11H13N5O5/c12-9-8-10(14-5-13-9)16(6-15-8)11(3-19,4-20)21-7(1-17)2-18/h1,3,5-7,18,20H,2,4H2,(H2,12,13,14)/t7-,11+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 295.255 g/mol | logS: -1.25671 | SlogP: -1.8596 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.117661 | Sterimol/B1: 2.46591 | Sterimol/B2: 3.64108 | Sterimol/B3: 4.55297 |
Sterimol/B4: 5.64501 | Sterimol/L: 13.793 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 476.128 | Positive charged surface: 370.97 | Negative charged surface: 105.158 | Volume: 244.375 |
Hydrophobic surface: 172.534 | Hydrophilic surface: 303.594 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |