 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC(=O)c1nc2c(nc1Nc1ccc(cc1)CC(=O)NC(CCC(O)=O)C(O)=O)cccc2 |
| InChI: | InChI=1/C22H20N4O7/c27-17(24-16(21(30)31)9-10-18(28)29)11-12-5-7-13(8-6-12)23-20-19(22(32)33)25-14-3-1-2-4-15(14)26-20/h1-8,16H,9-11H2,(H,23,26)(H,24,27)(H,28,29)(H,30,31)(H,32,33)/t16-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=127.642 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 452.423 g/mol | logS: -3.02095 | SlogP: 2.04827 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0320498 | Sterimol/B1: 2.75349 | Sterimol/B2: 2.91777 | Sterimol/B3: 4.37964 | |||
| Sterimol/B4: 8.66423 | Sterimol/L: 20.1342 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 731.021 | Positive charged surface: 438.294 | Negative charged surface: 292.727 | Volume: 394.25 | |||
| Hydrophobic surface: 374.376 | Hydrophilic surface: 356.645 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 8 | Hydrogen bond acceptors: 9 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules
