Type: Neutral
Formula: C15H17N3O2
SMILES: |
Oc1ccccc1\C=C/1\N=C(NC\1=O)N1CCCCC1 |
InChI: |
InChI=1/C15H17N3O2/c19-13-7-3-2-6-11(13)10-12-14(20)17-15(16-12)18-8-4-1-5-9-18/h2-3,6-7,10,19H,1,4-5,8-9H2,(H,16,17,20)/b12-10+ |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 271.32 g/mol | logS: -2.86073 | SlogP: 1.7048 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0438739 | Sterimol/B1: 2.50055 | Sterimol/B2: 2.92045 | Sterimol/B3: 3.87942 |
Sterimol/B4: 5.66676 | Sterimol/L: 15.8419 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 500.088 | Positive charged surface: 354.888 | Negative charged surface: 145.2 | Volume: 262.5 |
Hydrophobic surface: 368.088 | Hydrophilic surface: 132 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |