Type: Neutral
Formula: C11H22N4O4
SMILES: |
OC(=O)CC(N)C(=O)NC(NC(=O)NC(C)(C)C)C |
InChI: |
InChI=1/C11H22N4O4/c1-6(14-10(19)15-11(2,3)4)13-9(18)7(12)5-8(16)17/h6-7H,5,12H2,1-4H3,(H,13,18)(H,16,17)(H2,14,15,19)/t6-,7+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 274.321 g/mol | logS: -0.53559 | SlogP: -0.6517 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.122086 | Sterimol/B1: 2.00452 | Sterimol/B2: 2.62652 | Sterimol/B3: 4.3158 |
Sterimol/B4: 8.43779 | Sterimol/L: 14.0586 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 526.713 | Positive charged surface: 373.149 | Negative charged surface: 153.564 | Volume: 262.5 |
Hydrophobic surface: 237.11 | Hydrophilic surface: 289.603 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |