Type: Neutral
Formula: C11H22N4O4
SMILES: |
OC(=O)CC(N)C(=O)NC(NC(=O)NC(C)(C)C)C |
InChI: |
InChI=1/C11H22N4O4/c1-6(14-10(19)15-11(2,3)4)13-9(18)7(12)5-8(16)17/h6-7H,5,12H2,1-4H3,(H,13,18)(H,16,17)(H2,14,15,19)/t6-,7-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 274.321 g/mol | logS: -0.53559 | SlogP: -0.6517 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.0692772 | Sterimol/B1: 2.05055 | Sterimol/B2: 3.18647 | Sterimol/B3: 3.71321 |
Sterimol/B4: 7.46746 | Sterimol/L: 16.1783 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 532.285 | Positive charged surface: 373.809 | Negative charged surface: 158.476 | Volume: 261.125 |
Hydrophobic surface: 238.212 | Hydrophilic surface: 294.073 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |