Type: Neutral
Formula: C11H17N3O5
SMILES: |
O1C(CO)C(N(O)C)CC1N1C=C(C)C(=O)NC1=O |
InChI: |
InChI=1/C11H17N3O5/c1-6-4-14(11(17)12-10(6)16)9-3-7(13(2)18)8(5-15)19-9/h4,7-9,15,18H,3,5H2,1-2H3,(H,12,16,17)/t7-,8+,9-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 271.273 g/mol | logS: -0.06578 | SlogP: -0.7611 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.28689 | Sterimol/B1: 3.26186 | Sterimol/B2: 3.65449 | Sterimol/B3: 5.3138 |
Sterimol/B4: 6.20512 | Sterimol/L: 11.13 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 465.981 | Positive charged surface: 332.501 | Negative charged surface: 133.48 | Volume: 237.125 |
Hydrophobic surface: 248.821 | Hydrophilic surface: 217.16 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |