 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | s1cc(cc1)C(C(=O)NC1C2CCN(C1)CC2)c1ccccc1CC |
| InChI: | InChI=1/C21H26N2OS/c1-2-15-5-3-4-6-18(15)20(17-9-12-25-14-17)21(24)22-19-13-23-10-7-16(19)8-11-23/h3-6,9,12,14,16,19-20H,2,7-8,10-11,13H2,1H3,(H,22,24)/t19-,20+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=108.916 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 354.518 g/mol | logS: -4.55327 | SlogP: 3.65277 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.208558 | Sterimol/B1: 2.33082 | Sterimol/B2: 2.54788 | Sterimol/B3: 6.87078 | |||
| Sterimol/B4: 8.86825 | Sterimol/L: 14.7115 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 597.52 | Positive charged surface: 380.698 | Negative charged surface: 216.821 | Volume: 355 | |||
| Hydrophobic surface: 556.129 | Hydrophilic surface: 41.391 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
