Type: Neutral
Formula: C12H16N6O4
SMILES: |
O1C(C2OC(OC2C1n1nnc2c1ncnc2N)(C)C)CO |
InChI: |
InChI=1/C12H16N6O4/c1-12(2)21-7-5(3-19)20-11(8(7)22-12)18-10-6(16-17-18)9(13)14-4-15-10/h4-5,7-8,11,19H,3H2,1-2H3,(H2,13,14,15)/t5-,7+,8+,11-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 308.298 g/mol | logS: -1.86434 | SlogP: -0.6912 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.177931 | Sterimol/B1: 2.36125 | Sterimol/B2: 2.89753 | Sterimol/B3: 5.23234 |
Sterimol/B4: 6.95213 | Sterimol/L: 13.3189 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 509.542 | Positive charged surface: 364.95 | Negative charged surface: 144.592 | Volume: 262.875 |
Hydrophobic surface: 215.145 | Hydrophilic surface: 294.397 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |