Type: Neutral
Formula: C9H24N2O6P2
SMILES: |
P(O)(O)(=O)C(NCC)CCCC(P(O)(O)=O)NCC |
InChI: |
InChI=1/C9H24N2O6P2/c1-3-10-8(18(12,13)14)6-5-7-9(11-4-2)19(15,16)17/h8-11H,3-7H2,1-2H3,(H2,12,13,14)(H2,15,16,17)/t8-,9+ |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 318.247 g/mol | logS: 1.19343 | SlogP: -1.7571 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0524233 | Sterimol/B1: 2.4419 | Sterimol/B2: 2.85167 | Sterimol/B3: 3.70791 |
Sterimol/B4: 6.2468 | Sterimol/L: 16.3601 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 546.08 | Positive charged surface: 383.365 | Negative charged surface: 162.714 | Volume: 278.5 |
Hydrophobic surface: 267.461 | Hydrophilic surface: 278.619 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 8 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |