Type: Neutral
Formula: C11H14N4O5S
SMILES: |
S(C)C=1NC(=O)c2ncn(c2N=1)C1OCC(O)C(O)C1O |
InChI: |
InChI=1/C11H14N4O5S/c1-21-11-13-8-5(9(19)14-11)12-3-15(8)10-7(18)6(17)4(16)2-20-10/h3-4,6-7,10,16-18H,2H2,1H3,(H,13,14,19)/t4-,6-,7-,10+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 314.322 g/mol | logS: -1.76629 | SlogP: -1.316 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.113139 | Sterimol/B1: 2.52393 | Sterimol/B2: 3.32873 | Sterimol/B3: 4.12606 |
Sterimol/B4: 7.88848 | Sterimol/L: 12.6185 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 494.928 | Positive charged surface: 326.095 | Negative charged surface: 168.834 | Volume: 255.5 |
Hydrophobic surface: 219.362 | Hydrophilic surface: 275.566 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |