 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(CO)C(O)C(O)C1n1cc(c2c1N=CNC2=O)C(O)=O |
| InChI: | InChI=1/C12H13N3O7/c16-2-5-7(17)8(18)11(22-5)15-1-4(12(20)21)6-9(15)13-3-14-10(6)19/h1,3,5,7-8,11,16-18H,2H2,(H,20,21)(H,13,14,19)/t5-,7-,8-,11-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=71.27 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 311.25 g/mol | logS: -0.27021 | SlogP: -1.7035 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0640755 | Sterimol/B1: 2.97835 | Sterimol/B2: 3.27642 | Sterimol/B3: 4.69077 | |||
| Sterimol/B4: 6.32156 | Sterimol/L: 13.1498 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 496.248 | Positive charged surface: 344.785 | Negative charged surface: 151.463 | Volume: 252 | |||
| Hydrophobic surface: 142.442 | Hydrophilic surface: 353.806 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 6 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
