 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(=O)(=O)(N1CCCC1C(=O)NNC(=O)C([NH3+])Cc1ccccc1)c1ccc(cc1)C |
| InChI: | InChI=1/C21H26N4O4S/c1-15-9-11-17(12-10-15)30(28,29)25-13-5-8-19(25)21(27)24-23-20(26)18(22)14-16-6-3-2-4-7-16/h2-4,6-7,9-12,18-19H,5,8,13-14,22H2,1H3,(H,23,26)(H,24,27)/p+1/t18-,19-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=72.0296 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 431.537 g/mol | logS: -4.27814 | SlogP: 0.14869 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0572539 | Sterimol/B1: 2.43781 | Sterimol/B2: 2.71694 | Sterimol/B3: 5.90656 | |||
| Sterimol/B4: 7.98497 | Sterimol/L: 20.9989 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 712.105 | Positive charged surface: 441.471 | Negative charged surface: 270.635 | Volume: 402.625 | |||
| Hydrophobic surface: 531.202 | Hydrophilic surface: 180.903 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
