 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC(Cc1ccccc1)C(=O)NN)C1[NH2+]CCC1 |
| InChI: | InChI=1/C14H20N4O2/c15-18-14(20)12(9-10-5-2-1-3-6-10)17-13(19)11-7-4-8-16-11/h1-3,5-6,11-12,16H,4,7-9,15H2,(H,17,19)(H,18,20)/p+1/t11-,12-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=74.7535 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 277.348 g/mol | logS: -2.1459 | SlogP: -1.57043 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.151602 | Sterimol/B1: 2.45187 | Sterimol/B2: 3.48842 | Sterimol/B3: 4.0182 | |||
| Sterimol/B4: 9.78556 | Sterimol/L: 12.6985 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 533.486 | Positive charged surface: 369.056 | Negative charged surface: 164.43 | Volume: 273.25 | |||
| Hydrophobic surface: 341.48 | Hydrophilic surface: 192.006 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
