Type: Neutral
Formula: C20H34O2
SMILES: |
OCC1(C2CCC(=C)C(CCC(O)(C=C)C)C2(CCC1)C)C |
InChI: |
InChI=1/C20H34O2/c1-6-19(4,22)13-10-16-15(2)8-9-17-18(3,14-21)11-7-12-20(16,17)5/h6,16-17,21-22H,1-2,7-14H2,3-5H3/t16-,17-,18+,19+,20-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 306.49 g/mol | logS: -4.80155 | SlogP: 4.4748 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.126266 | Sterimol/B1: 2.29229 | Sterimol/B2: 2.5399 | Sterimol/B3: 5.33282 |
Sterimol/B4: 6.6704 | Sterimol/L: 16.5562 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 547.873 | Positive charged surface: 383.148 | Negative charged surface: 164.725 | Volume: 334.375 |
Hydrophobic surface: 363.196 | Hydrophilic surface: 184.677 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |