 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC(Cc1c2c([nH]c1)cccc2)C(=O)[O-])C([NH3+])CCC(=O)[O-] |
| InChI: | InChI=1/C16H19N3O5/c17-11(5-6-14(20)21)15(22)19-13(16(23)24)7-9-8-18-12-4-2-1-3-10(9)12/h1-4,8,11,13,18H,5-7,17H2,(H,19,22)(H,20,21)(H,23,24)/p-1/t11-,13+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=37.243 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 332.336 g/mol | logS: -2.14562 | SlogP: -2.91433 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.242486 | Sterimol/B1: 3.48229 | Sterimol/B2: 4.19102 | Sterimol/B3: 5.06422 | |||
| Sterimol/B4: 7.57704 | Sterimol/L: 13.3907 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 540.56 | Positive charged surface: 302.397 | Negative charged surface: 235.341 | Volume: 300.875 | |||
| Hydrophobic surface: 252.376 | Hydrophilic surface: 288.184 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 1 | Acid groups: 4 | Basic groups: 1 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
