 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(Cc1ccccc1)C(=O)NC(Cc1c2c([nH]c1)cccc2)C(=O)NC(C(O)=O)C |
| InChI: | InChI=1/C22H23N3O5/c1-14(21(27)28)24-20(26)19(11-16-12-23-18-10-6-5-9-17(16)18)25-22(29)30-13-15-7-3-2-4-8-15/h2-10,12,14,19,23H,11,13H2,1H3,(H,24,26)(H,25,29)(H,27,28)/t14-,19+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=65.7391 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 409.442 g/mol | logS: -4.22272 | SlogP: 2.86107 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0889281 | Sterimol/B1: 2.33211 | Sterimol/B2: 4.12408 | Sterimol/B3: 5.30432 | |||
| Sterimol/B4: 8.86117 | Sterimol/L: 17.9124 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 707.149 | Positive charged surface: 420.054 | Negative charged surface: 284.152 | Volume: 385.25 | |||
| Hydrophobic surface: 478.005 | Hydrophilic surface: 229.144 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
