Type: Neutral
Formula: C11H15N2O6P
SMILES: |
P1(OC2CC(OC2CO1)N1C=C(C)C(=O)NC1=O)(=O)C |
InChI: |
InChI=1/C11H15N2O6P/c1-6-4-13(11(15)12-10(6)14)9-3-7-8(18-9)5-17-20(2,16)19-7/h4,7-9H,3,5H2,1-2H3,(H,12,14,15)/t7-,8-,9+,20+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 302.223 g/mol | logS: -0.86767 | SlogP: -0.2749 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0693295 | Sterimol/B1: 2.93139 | Sterimol/B2: 3.29582 | Sterimol/B3: 3.68071 |
Sterimol/B4: 5.40316 | Sterimol/L: 15.0403 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 480.511 | Positive charged surface: 294.281 | Negative charged surface: 186.231 | Volume: 246.375 |
Hydrophobic surface: 284.055 | Hydrophilic surface: 196.456 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |