 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC(=O)C(NC(=O)c1ccccc1)CCCNC(NC(=O)c1ccccc1)=N |
| InChI: | InChI=1/C20H22N4O4/c21-20(24-18(26)15-10-5-2-6-11-15)22-13-7-12-16(19(27)28)23-17(25)14-8-3-1-4-9-14/h1-6,8-11,16H,7,12-13H2,(H,23,25)(H,27,28)(H3,21,22,24,26)/t16-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=42.8443 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 382.42 g/mol | logS: -4.30015 | SlogP: 1.60417 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0606861 | Sterimol/B1: 3.5235 | Sterimol/B2: 3.86279 | Sterimol/B3: 4.53772 | |||
| Sterimol/B4: 8.47242 | Sterimol/L: 17.3033 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 681.362 | Positive charged surface: 400.058 | Negative charged surface: 281.304 | Volume: 360.75 | |||
| Hydrophobic surface: 459.697 | Hydrophilic surface: 221.665 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 6 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
