Type: Neutral
Formula: C8H16N6O4S2
SMILES: |
S(SCC(NC(N)=N)C(O)=O)CC(NC(N)=N)C(O)=O |
InChI: |
InChI=1/C8H16N6O4S2/c9-7(10)13-3(5(15)16)1-19-20-2-4(6(17)18)14-8(11)12/h3-4H,1-2H2,(H,15,16)(H,17,18)(H4,9,10,13)(H4,11,12,14)/t3-,4-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 324.386 g/mol | logS: -2.31898 | SlogP: -1.75966 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.0765531 | Sterimol/B1: 3.04691 | Sterimol/B2: 3.17996 | Sterimol/B3: 3.57533 |
Sterimol/B4: 6.45896 | Sterimol/L: 13.5116 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 538.275 | Positive charged surface: 331.002 | Negative charged surface: 207.274 | Volume: 263.5 |
Hydrophobic surface: 62.9 | Hydrophilic surface: 475.375 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 10 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |