 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(N)C(NC(=O)C([NH3+])CC(C)C)Cc1c2c([nH]c1)cccc2 |
| InChI: | InChI=1/C17H24N4O2/c1-10(2)7-13(18)17(23)21-15(16(19)22)8-11-9-20-14-6-4-3-5-12(11)14/h3-6,9-10,13,15,20H,7-8,18H2,1-2H3,(H2,19,22)(H,21,23)/p+1/t13-,15-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=49.6768 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 317.413 g/mol | logS: -3.38733 | SlogP: 0.33707 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.162814 | Sterimol/B1: 2.59522 | Sterimol/B2: 3.79222 | Sterimol/B3: 5.00039 | |||
| Sterimol/B4: 8.23693 | Sterimol/L: 15.3865 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 595.214 | Positive charged surface: 395.601 | Negative charged surface: 196.62 | Volume: 323.75 | |||
| Hydrophobic surface: 344.229 | Hydrophilic surface: 250.985 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
