 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(C)c1ccc(Nc2nc(NC3CCC([NH+](C)C)CC3)c3c(n2)cccc3)cc1C[NH2+] CC |
| InChI: | InChI=1/C26H36N6O/c1-5-27-17-18-16-20(12-15-24(18)33-4)29-26-30-23-9-7-6-8-22(23)25(31-26)28-19-10-13-21(14-11-19)32(2)3/h6-9,12,15-16,19,21,27H,5,10-11,13-14,17H2,1-4H3,(H2,28,29,30,31)/p+2/t19-,21+ |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=51.3055 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 450.631 g/mol | logS: -5.38732 | SlogP: 2.5993 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0558149 | Sterimol/B1: 2.16434 | Sterimol/B2: 2.43305 | Sterimol/B3: 6.60916 | |||
| Sterimol/B4: 10.795 | Sterimol/L: 20.6272 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 824.758 | Positive charged surface: 659.397 | Negative charged surface: 159.952 | Volume: 472.375 | |||
| Hydrophobic surface: 671.769 | Hydrophilic surface: 152.989 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 2 | |||
| Chiral centers: 0 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
