Type: Neutral
Formula: C11H15N5O4
SMILES: |
O1C(CO)C(O)C(OC)C1n1c2ncnc(N)c2nc1 |
InChI: |
InChI=1/C11H15N5O4/c1-19-8-7(18)5(2-17)20-11(8)16-4-15-6-9(12)13-3-14-10(6)16/h3-5,7-8,11,17-18H,2H2,1H3,(H2,12,13,14)/t5-,7-,8+,11-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 281.272 g/mol | logS: -1.30786 | SlogP: -1.2304 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.131005 | Sterimol/B1: 1.99631 | Sterimol/B2: 2.4756 | Sterimol/B3: 5.50304 |
Sterimol/B4: 6.9852 | Sterimol/L: 13.7951 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 488.249 | Positive charged surface: 396.678 | Negative charged surface: 91.5711 | Volume: 245.375 |
Hydrophobic surface: 227.798 | Hydrophilic surface: 260.451 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |