 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(\C=C\c1ccccc1)CCC(C=O)C1CCC(CC1)CCCC |
| InChI: | InChI=1/C23H32O2/c1-2-3-7-20-10-13-21(14-11-20)22(18-24)15-17-23(25)16-12-19-8-5-4-6-9-19/h4-6,8-9,12,16,18,20-22H,2-3,7,10-11,13-15,17H2,1H3/b16-12+/t20-,21-,22-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=64.4311 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 340.507 g/mol | logS: -6.93048 | SlogP: 5.8608 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.0238805 | Sterimol/B1: 2.27225 | Sterimol/B2: 2.66356 | Sterimol/B3: 3.61127 | |||
| Sterimol/B4: 8.38327 | Sterimol/L: 22.5658 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 681.403 | Positive charged surface: 456.493 | Negative charged surface: 224.91 | Volume: 375.5 | |||
| Hydrophobic surface: 585.648 | Hydrophilic surface: 95.755 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 0 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.