 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Oc1ccc(cc1)CC(NC(=O)C([NH3+])CCCC[NH3+])C(=O)NC(CCCC[NH3+])C (=O)[O-] |
| InChI: | InChI=1/C21H35N5O5/c22-11-3-1-5-16(24)19(28)26-18(13-14-7-9-15(27)10-8-14)20(29)25-17(21(30)31)6-2-4-12-23/h7-10,16-18,27H,1-6,11-13,22-24H2,(H,25,29)(H,26,28)(H,30,31)/p+2/t16-,17+,18+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=72.2637 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 439.557 g/mol | logS: -1.87092 | SlogP: -3.91093 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.102944 | Sterimol/B1: 3.29374 | Sterimol/B2: 4.1196 | Sterimol/B3: 5.86461 | |||
| Sterimol/B4: 8.61003 | Sterimol/L: 17.6166 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 788.151 | Positive charged surface: 610.378 | Negative charged surface: 177.773 | Volume: 438.125 | |||
| Hydrophobic surface: 386.262 | Hydrophilic surface: 401.889 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 2 | Basic groups: 3 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
