Type: Neutral
Formula: C24H24N2
| SMILES: |
[nH]1c2CCCCc2c2c1cc(cc2)C12C(=Nc3c1cccc3)CCCC2 |
| InChI: |
InChI=1/C24H24N2/c1-3-9-20-17(7-1)18-13-12-16(15-22(18)25-20)24-14-6-5-11-23(24)26-21-10-4-2-8-19(21)24/h2,4,8,10,12-13,15,25H,1,3,5-7,9,11,14H2/t24-/m0/s1 |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 340.47 g/mol | logS: -5.86964 | SlogP: 5.99284 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.128196 | Sterimol/B1: 2.46893 | Sterimol/B2: 2.92266 | Sterimol/B3: 5.8309 |
| Sterimol/B4: 8.57644 | Sterimol/L: 14.5185 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 591.147 | Positive charged surface: 408.623 | Negative charged surface: 177.157 | Volume: 346.75 |
| Hydrophobic surface: 545.724 | Hydrophilic surface: 45.423 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 0 |
| Chiral centers: 1 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
| |
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |