Type: Neutral
Formula: C16H18N2O7S
SMILES: |
S(OC1CC(OC1CO)N1C=C(C)C(=O)NC1=O)(=O)(=O)c1ccccc1 |
InChI: |
InChI=1/C16H18N2O7S/c1-10-8-18(16(21)17-15(10)20)14-7-12(13(9-19)24-14)25-26(22,23)11-5-3-2-4-6-11/h2-6,8,12-14,19H,7,9H2,1H3,(H,17,20,21)/t12-,13+,14+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 382.393 g/mol | logS: -2.68504 | SlogP: 0.3234 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.126053 | Sterimol/B1: 4.35514 | Sterimol/B2: 4.45136 | Sterimol/B3: 4.50402 |
Sterimol/B4: 5.44429 | Sterimol/L: 16.5884 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 576.844 | Positive charged surface: 324.809 | Negative charged surface: 252.035 | Volume: 317.625 |
Hydrophobic surface: 352.432 | Hydrophilic surface: 224.412 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |