Type: Neutral
Formula: C13H16N2O7
SMILES: |
O1CC(CO)C(O)C1N1C=C(\C=C\C(OC)=O)C(=O)NC1=O |
InChI: |
InChI=1/C13H16N2O7/c1-21-9(17)3-2-7-4-15(13(20)14-11(7)19)12-10(18)8(5-16)6-22-12/h2-4,8,10,12,16,18H,5-6H2,1H3,(H,14,19,20)/b3-2+/t8-,10+,12-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 312.278 g/mol | logS: -1.0741 | SlogP: -1.523 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0403399 | Sterimol/B1: 2.89415 | Sterimol/B2: 3.02793 | Sterimol/B3: 3.86478 |
Sterimol/B4: 4.98964 | Sterimol/L: 18.6086 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 526.434 | Positive charged surface: 369.572 | Negative charged surface: 156.862 | Volume: 267.25 |
Hydrophobic surface: 295.915 | Hydrophilic surface: 230.519 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |