 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(CO)C(O)C([O-])C1n1c2ncnc(NCC(c3ccccc3C)c3cc(OC)cc(OC)c3) c2nc1 |
| InChI: | InChI=1/C27H30N5O6/c1-15-6-4-5-7-19(15)20(16-8-17(36-2)10-18(9-16)37-3)11-28-25-22-26(30-13-29-25)32(14-31-22)27-24(35)23(34)21(12-33)38-27/h4-10,13-14,20-21,23-24,27,33-34H,11-12H2,1-3H3,(H,28,29,30)/q-1/t20-,21+,23-,24+,27+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=132.075 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 520.566 g/mol | logS: -5.15629 | SlogP: 2.54112 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0827816 | Sterimol/B1: 3.50146 | Sterimol/B2: 3.79269 | Sterimol/B3: 6.67964 | |||
| Sterimol/B4: 8.58806 | Sterimol/L: 20.827 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 834.311 | Positive charged surface: 595.78 | Negative charged surface: 238.531 | Volume: 487.125 | |||
| Hydrophobic surface: 607.031 | Hydrophilic surface: 227.28 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 8 | Acid groups: 1 | Basic groups: 0 | |||
| Chiral centers: 5 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 0 | Violations of Lipinski's rule: 2 | Oprea's lead like rule: 0 | ||||
|
